C22H25N7O2 — CID 137124159
[4-[[6-amino-5-(7-hydroxy-1H-indole-2-carboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-cyclopropylmethanone (PubChem CID 137124159) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is [4-[[6-amino-5-(7-hydroxy-1H-indole-2-carboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-cyclopropylmethanone.
| Compound Name | [4-[[6-amino-5-(7-hydroxy-1H-indole-2-carboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 137124159 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [4-[[6-amino-5-(7-hydroxy-1H-indole-2-carboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-cyclopropylmethanone |
| SMILES | [H]/N=C(\c1cc2cccc(O)c2[nH]1)c1c(N)ncnc1NC1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C22H25N7O2/c23-18(15-10-13-2-1-3-16(30)19(13)28-15)17-20(24)25-11-26-21(17)27-14-6-8-29(9-7-14)22(31)12-4-5-12/h1-3,10-12,14,23,28,30H,4-9H2,(H3,24,25,26,27)/b23-18+ |
| InChIKey | PWVQCYARLSPOIS-PTGBLXJZSA-N |
| XLogP | 2.47 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|