C23H16N6O3 — CID 137103686
(3Z,5Z)-3,5-bis[(2-hydroxynaphthalen-1-yl)hydrazinylidene]pyrazol-4-one (PubChem CID 137103686) has the molecular formula C23H16N6O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(2-hydroxynaphthalen-1-yl)hydrazinylidene]pyrazol-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(2-hydroxynaphthalen-1-yl)hydrazinylidene]pyrazol-4-one |
|---|---|
| PubChem CID | 137103686 |
| Molecular Formula | C23H16N6O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(2-hydroxynaphthalen-1-yl)hydrazinylidene]pyrazol-4-one |
| SMILES | O=c1/c(=N/Nc2c(O)ccc3ccccc23)nn/c1=N\Nc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H16N6O3/c30-17-11-9-13-5-1-3-7-15(13)19(17)24-26-22-21(32)23(29-28-22)27-25-20-16-8-4-2-6-14(16)10-12-18(20)31/h1-12,24-25,30-31H/b26-22-,27-23- |
| InChIKey | WMHSYMOZFRLXSF-VDUNRZOZSA-N |
| XLogP | 2.29 |
| TPSA | 132.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|