C15H13ClN4O2 — CID 137117444
N,N'-diamino-2-[3-chloro-4-(furan-2-yl)benzoyl]cyclopropene-1-carboximidamide (PubChem CID 137117444) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is N,N'-diamino-2-[3-chloro-4-(furan-2-yl)benzoyl]cyclopropene-1-carboximidamide.
| Compound Name | N,N'-diamino-2-[3-chloro-4-(furan-2-yl)benzoyl]cyclopropene-1-carboximidamide |
|---|---|
| PubChem CID | 137117444 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N,N'-diamino-2-[3-chloro-4-(furan-2-yl)benzoyl]cyclopropene-1-carboximidamide |
| SMILES | N/N=C(/NN)C1=C(C(=O)c2ccc(-c3ccco3)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H13ClN4O2/c16-12-6-8(3-4-9(12)13-2-1-5-22-13)14(21)10-7-11(10)15(19-17)20-18/h1-6H,7,17-18H2,(H,19,20) |
| InChIKey | NTKYKQCDBHCPQV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|