C7H14N4O — CID 145191958
N,N'-diaminofuran-2-carboximidamide;ethane (PubChem CID 145191958) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is N,N'-diaminofuran-2-carboximidamide;ethane.
| Compound Name | N,N'-diaminofuran-2-carboximidamide;ethane |
|---|---|
| PubChem CID | 145191958 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N,N'-diaminofuran-2-carboximidamide;ethane |
| SMILES | CC.N/N=C(\NN)c1ccco1 |
| InChI | InChI=1S/C5H8N4O.C2H6/c6-8-5(9-7)4-2-1-3-10-4;1-2/h1-3H,6-7H2,(H,8,9);1-2H3 |
| InChIKey | BZNPSPLAVCRABJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|