C22H20ClNO4 — CID 72710540
2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(furan-2-yl)benzoic acid (PubChem CID 72710540) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(furan-2-yl)benzoic acid.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(furan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 72710540 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(furan-2-yl)benzoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc(Cl)c(-c3ccco3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H20ClNO4/c1-22(2,3)14-8-6-13(7-9-14)20(25)24-18-12-17(23)15(11-16(18)21(26)27)19-5-4-10-28-19/h4-12H,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | SWEWBXPEXGPXDZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |