C24H21ClFNO3 — CID 71306385
2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(4-fluorophenyl)benzoic acid (PubChem CID 71306385) has the molecular formula C24H21ClFNO3 and a molecular weight of 425.89 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(4-fluorophenyl)benzoic acid.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(4-fluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 71306385 |
| Molecular Formula | C24H21ClFNO3 |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-(4-fluorophenyl)benzoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc(Cl)c(-c3ccc(F)cc3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H21ClFNO3/c1-24(2,3)16-8-4-15(5-9-16)22(28)27-21-13-20(25)18(12-19(21)23(29)30)14-6-10-17(26)11-7-14/h4-13H,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | YSWUKGBXTPCAKQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |