C23H21ClN2O3 — CID 71307927
2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-pyridin-3-ylbenzoic acid (PubChem CID 71307927) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-pyridin-3-ylbenzoic acid.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-pyridin-3-ylbenzoic acid |
|---|---|
| PubChem CID | 71307927 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-4-chloro-5-pyridin-3-ylbenzoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc(Cl)c(-c3cccnc3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H21ClN2O3/c1-23(2,3)16-8-6-14(7-9-16)21(27)26-20-12-19(24)17(11-18(20)22(28)29)15-5-4-10-25-13-15/h4-13H,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | MMJSXYJOVHKKRD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |