C7H12N4O2 — CID 137121570
(1Z,2E)-2-amino-N-butan-2-yloxy-2-hydroxyiminoethanimidoyl cyanide (PubChem CID 137121570) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is (1Z,2E)-2-amino-N-butan-2-yloxy-2-hydroxyiminoethanimidoyl cyanide.
| Compound Name | (1Z,2E)-2-amino-N-butan-2-yloxy-2-hydroxyiminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 137121570 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (1Z,2E)-2-amino-N-butan-2-yloxy-2-hydroxyiminoethanimidoyl cyanide |
| SMILES | CCC(C)O/N=C(C#N)\C(N)=N/O |
| InChI | InChI=1S/C7H12N4O2/c1-3-5(2)13-11-6(4-8)7(9)10-12/h5,12H,3H2,1-2H3,(H2,9,10)/b11-6- |
| InChIKey | ILDWDJOHKNKEKA-WDZFZDKYSA-N |
| XLogP | 0.43 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|