C12H10FN5 — CID 137123533
2-(2-fluorophenyl)-1-methyl-7H-purin-6-imine (PubChem CID 137123533) has the molecular formula C12H10FN5 and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-methyl-7H-purin-6-imine.
| Compound Name | 2-(2-fluorophenyl)-1-methyl-7H-purin-6-imine |
|---|---|
| PubChem CID | 137123533 |
| Molecular Formula | C12H10FN5 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(2-fluorophenyl)-1-methyl-7H-purin-6-imine |
| SMILES | [H]/N=c1/c2[nH]cnc2nc(-c2ccccc2F)n1C |
| InChI | InChI=1S/C12H10FN5/c1-18-10(14)9-11(16-6-15-9)17-12(18)7-4-2-3-5-8(7)13/h2-6,14H,1H3,(H,15,16)/b14-10- |
| InChIKey | YFDIRWFIEWLHCR-UVTDQMKNSA-N |
| XLogP | 1.58 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |