C22H20FN5OS — CID 3228918
2-[[2-(2-fluorophenyl)-7H-purin-6-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 3228918) has the molecular formula C22H20FN5OS and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenyl)-7H-purin-6-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[[2-(2-fluorophenyl)-7H-purin-6-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3228918 |
| Molecular Formula | C22H20FN5OS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[[2-(2-fluorophenyl)-7H-purin-6-yl]sulfanyl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)CSc2nc(-c3ccccc3F)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C22H20FN5OS/c1-13(2)14-7-9-15(10-8-14)26-18(29)11-30-22-19-21(25-12-24-19)27-20(28-22)16-5-3-4-6-17(16)23/h3-10,12-13H,11H2,1-2H3,(H,26,29)(H,24,25,27,28) |
| InChIKey | LAVDVVFRAAVHHU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |