C9H10FN5 — CID 35754935
[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]hydrazine (PubChem CID 35754935) has the molecular formula C9H10FN5 and a molecular weight of 207.21 g/mol. Its IUPAC name is [5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]hydrazine.
| Compound Name | [5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]hydrazine |
|---|---|
| PubChem CID | 35754935 |
| Molecular Formula | C9H10FN5 |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | [5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]hydrazine |
| SMILES | Cn1c(NN)nnc1-c1ccccc1F |
| InChI | InChI=1S/C9H10FN5/c1-15-8(13-14-9(15)12-11)6-4-2-3-5-7(6)10/h2-5H,11H2,1H3,(H,12,14) |
| InChIKey | UWAWOOUZBRDKNR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|