C21H25N2+ — CID 137126483
ethyl-[5-(N-ethylanilino)penta-2,4-dienylidene]-phenylazanium (PubChem CID 137126483) has the molecular formula C21H25N2+ and a molecular weight of 305.45 g/mol. Its IUPAC name is ethyl-[5-(N-ethylanilino)penta-2,4-dienylidene]-phenylazanium.
| Compound Name | ethyl-[5-(N-ethylanilino)penta-2,4-dienylidene]-phenylazanium |
|---|---|
| PubChem CID | 137126483 |
| Molecular Formula | C21H25N2+ |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethyl-[5-(N-ethylanilino)penta-2,4-dienylidene]-phenylazanium |
| SMILES | CCN(C=CC=C/C=[N+](\CC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N2/c1-3-22(20-14-8-5-9-15-20)18-12-7-13-19-23(4-2)21-16-10-6-11-17-21/h5-19H,3-4H2,1-2H3/q+1 |
| InChIKey | BHTSRVHCUDJLTN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|