C17H29F6NO18P6 — CID 173031516
cinnamylidene-ethyl-phenylazanium;fluoro(hydroxy)phosphinate;fluorophosphonic acid (PubChem CID 173031516) has the molecular formula C17H29F6NO18P6 and a molecular weight of 835.24 g/mol. Its IUPAC name is cinnamylidene-ethyl-phenylazanium;fluoro(hydroxy)phosphinate;fluorophosphonic acid.
| Compound Name | cinnamylidene-ethyl-phenylazanium;fluoro(hydroxy)phosphinate;fluorophosphonic acid |
|---|---|
| PubChem CID | 173031516 |
| Molecular Formula | C17H29F6NO18P6 |
| Molecular Weight | 835.24 g/mol |
| Exact Mass | 834.97 |
| IUPAC Name | cinnamylidene-ethyl-phenylazanium;fluoro(hydroxy)phosphinate;fluorophosphonic acid |
| SMILES | CC/[N+](=C\C=Cc1ccccc1)c1ccccc1.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P([O-])(O)F |
| InChI | InChI=1S/C17H18N.6FH2O3P/c1-2-18(17-13-7-4-8-14-17)15-9-12-16-10-5-3-6-11-16;6*1-5(2,3)4/h3-15H,2H2,1H3;6*(H2,2,3,4)/q+1;;;;;;/p-1/b12-9?,18-15+;;;;;; |
| InChIKey | XOMAGMIZUNHQEZ-ZKTLRCRYSA-M |
| XLogP | 3.79 |
| TPSA | 351.02 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|