C16H17NO — CID 174387898
4-[ethyl(2-phenylethenyl)amino]phenol (PubChem CID 174387898) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-[ethyl(2-phenylethenyl)amino]phenol.
| Compound Name | 4-[ethyl(2-phenylethenyl)amino]phenol |
|---|---|
| PubChem CID | 174387898 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-[ethyl(2-phenylethenyl)amino]phenol |
| SMILES | CCN(C=Cc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H17NO/c1-2-17(15-8-10-16(18)11-9-15)13-12-14-6-4-3-5-7-14/h3-13,18H,2H2,1H3 |
| InChIKey | PKBGTSBLTLBKLH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |