C24H21FN4O — CID 137132042
(11R,12R)-7-fluoro-11-[4-(methylaminomethyl)phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 137132042) has the molecular formula C24H21FN4O and a molecular weight of 400.46 g/mol. Its IUPAC name is (11R,12R)-7-fluoro-11-[4-(methylaminomethyl)phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | (11R,12R)-7-fluoro-11-[4-(methylaminomethyl)phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 137132042 |
| Molecular Formula | C24H21FN4O |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (11R,12R)-7-fluoro-11-[4-(methylaminomethyl)phenyl]-12-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | CNCc1ccc([C@@H]2Nc3cc(F)cc4c(=O)[nH]nc(c34)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21FN4O/c1-26-13-14-7-9-16(10-8-14)22-20(15-5-3-2-4-6-15)23-21-18(24(30)29-28-23)11-17(25)12-19(21)27-22/h2-12,20,22,26-27H,13H2,1H3,(H,29,30)/t20-,22+/m1/s1 |
| InChIKey | GKAZTLDHHGDFSF-IRLDBZIGSA-N |
| XLogP | 4.08 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |