C20H25N3OS — CID 137142820
2,4-ditert-butyl-6-(5-sulfanylbenzotriazol-2-yl)phenol (PubChem CID 137142820) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(5-sulfanylbenzotriazol-2-yl)phenol.
| Compound Name | 2,4-ditert-butyl-6-(5-sulfanylbenzotriazol-2-yl)phenol |
|---|---|
| PubChem CID | 137142820 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2,4-ditert-butyl-6-(5-sulfanylbenzotriazol-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(-n2nc3ccc(S)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H25N3OS/c1-19(2,3)12-9-14(20(4,5)6)18(24)17(10-12)23-21-15-8-7-13(25)11-16(15)22-23/h7-11,24-25H,1-6H3 |
| InChIKey | YISOHPAUCQJPBY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|