C21H24ClN3O3 — CID 88753536
[2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl] carbonochloridate (PubChem CID 88753536) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is [2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl] carbonochloridate.
| Compound Name | [2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl] carbonochloridate |
|---|---|
| PubChem CID | 88753536 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [2-(3,5-ditert-butyl-2-hydroxyphenyl)benzotriazol-5-yl] carbonochloridate |
| SMILES | CC(C)(C)c1cc(-n2nc3ccc(OC(=O)Cl)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-20(2,3)12-9-14(21(4,5)6)18(26)17(10-12)25-23-15-8-7-13(28-19(22)27)11-16(15)24-25/h7-11,26H,1-6H3 |
| InChIKey | MCGMYHGHRMXAFX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|