C13H12N6O2 — CID 137152156
N'-diazenyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4-carboximidamide (PubChem CID 137152156) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is N'-diazenyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4-carboximidamide.
| Compound Name | N'-diazenyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 137152156 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N'-diazenyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4-carboximidamide |
| SMILES | [H]/N=N/N=C(N)c1cc(-c2ccc3c(c2)OCCO3)ncn1 |
| InChI | InChI=1S/C13H12N6O2/c14-13(18-19-15)10-6-9(16-7-17-10)8-1-2-11-12(5-8)21-4-3-20-11/h1-2,5-7H,3-4H2,(H3,14,15,18) |
| InChIKey | QGHVFPXHDMTPGP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|