C17H15N9 — CID 137154233
5-[[3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]pyrazine-2-carbonitrile (PubChem CID 137154233) has the molecular formula C17H15N9 and a molecular weight of 345.37 g/mol. Its IUPAC name is 5-[[3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 137154233 |
| Molecular Formula | C17H15N9 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 5-[[3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(NC2CCC(c3nnc4cnc5[nH]ccc5n34)C2)cn1 |
| InChI | InChI=1S/C17H15N9/c18-6-12-7-21-14(8-20-12)23-11-2-1-10(5-11)17-25-24-15-9-22-16-13(26(15)17)3-4-19-16/h3-4,7-11,19H,1-2,5H2,(H,21,23) |
| InChIKey | RSAXWGSYEWHTQB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |