C19H18N8 — CID 136991187
(2E)-2-(aminomethylidene)-5-[[(1R,3S)-3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]hex-5-en-3-ynenitrile (PubChem CID 136991187) has the molecular formula C19H18N8 and a molecular weight of 358.41 g/mol. Its IUPAC name is (2E)-2-(aminomethylidene)-5-[[(1R,3S)-3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]hex-5-en-3-ynenitrile.
| Compound Name | (2E)-2-(aminomethylidene)-5-[[(1R,3S)-3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]hex-5-en-3-ynenitrile |
|---|---|
| PubChem CID | 136991187 |
| Molecular Formula | C19H18N8 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2E)-2-(aminomethylidene)-5-[[(1R,3S)-3-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]amino]hex-5-en-3-ynenitrile |
| SMILES | C=C(C#C/C(C#N)=C\N)N[C@@H]1CC[C@H](c2nnc3cnc4[nH]ccc4n23)C1 |
| InChI | InChI=1S/C19H18N8/c1-12(2-3-13(9-20)10-21)24-15-5-4-14(8-15)19-26-25-17-11-23-18-16(27(17)19)6-7-22-18/h6-7,9,11,14-15,22,24H,1,4-5,8,20H2/b13-9+/t14-,15+/m0/s1 |
| InChIKey | LJXIMFGOFRXRIU-WMHHWXMBSA-N |
| XLogP | 1.71 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|