C22H28N8 — CID 143911940
2-[[(Z)-prop-1-enyl]iminomethyl]prop-2-enenitrile;(4R)-N,3,3-trimethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine (PubChem CID 143911940) has the molecular formula C22H28N8 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[[(Z)-prop-1-enyl]iminomethyl]prop-2-enenitrile;(4R)-N,3,3-trimethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine.
| Compound Name | 2-[[(Z)-prop-1-enyl]iminomethyl]prop-2-enenitrile;(4R)-N,3,3-trimethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 143911940 |
| Molecular Formula | C22H28N8 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-[[(Z)-prop-1-enyl]iminomethyl]prop-2-enenitrile;(4R)-N,3,3-trimethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentan-1-amine |
| SMILES | C=C(C#N)/C=N/C=C\C.CNC1C[C@@H](c2nnc3cnc4[nH]ccc4n23)C(C)(C)C1 |
| InChI | InChI=1S/C15H20N6.C7H8N2/c1-15(2)7-9(16-3)6-10(15)14-20-19-12-8-18-13-11(21(12)14)4-5-17-13;1-3-4-9-6-7(2)5-8/h4-5,8-10,16-17H,6-7H2,1-3H3;3-4,6H,2H2,1H3/b;4-3-,9-6+/t9?,10-;/m0./s1 |
| InChIKey | LQPFCLCSMVYDQH-CFQUGJKYSA-N |
| XLogP | 3.77 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|