C16H19N7O — CID 143912029
2-cyanoacetamide;12-cyclohexyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 143912029) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is 2-cyanoacetamide;12-cyclohexyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 2-cyanoacetamide;12-cyclohexyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 143912029 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-cyanoacetamide;12-cyclohexyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | N#CCC(N)=O.c1cc2c(ncc3nnc(C4CCCCC4)n32)[nH]1 |
| InChI | InChI=1S/C13H15N5.C3H4N2O/c1-2-4-9(5-3-1)13-17-16-11-8-15-12-10(18(11)13)6-7-14-12;4-2-1-3(5)6/h6-9,14H,1-5H2;1H2,(H2,5,6) |
| InChIKey | BUJNZABQICHBIS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |