C23H22ClIN2O6S — CID 137162432
ethyl 2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 137162432) has the molecular formula C23H22ClIN2O6S and a molecular weight of 616.86 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 137162432 |
| Molecular Formula | C23H22ClIN2O6S |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 615.99 |
| IUPAC Name | ethyl 2-[4-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2\S/C(=N/c3cc(Cl)ccc3OC)NC2=O)cc1OCC |
| InChI | InChI=1S/C23H22ClIN2O6S/c1-4-31-18-9-13(8-15(25)21(18)33-12-20(28)32-5-2)10-19-22(29)27-23(34-19)26-16-11-14(24)6-7-17(16)30-3/h6-11H,4-5,12H2,1-3H3,(H,26,27,29)/b19-10- |
| InChIKey | QXRDWPAZQGBKEU-GRSHGNNSSA-N |
| XLogP | 5.19 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|