C17H24N6O3S — CID 137166989
2-ethoxy-N-[3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethanesulfonamide (PubChem CID 137166989) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-ethoxy-N-[3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethanesulfonamide.
| Compound Name | 2-ethoxy-N-[3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethanesulfonamide |
|---|---|
| PubChem CID | 137166989 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-ethoxy-N-[3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)NC1CC(C)C(c2nnc3cnc4[nH]ccc4n23)C1 |
| InChI | InChI=1S/C17H24N6O3S/c1-3-26-6-7-27(24,25)22-12-8-11(2)13(9-12)17-21-20-15-10-19-16-14(23(15)17)4-5-18-16/h4-5,10-13,18,22H,3,6-9H2,1-2H3 |
| InChIKey | HBSKITCAZUGWOY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|