C18H22Cl2N6O2S — CID 137072840
1-(2,2-dichlorocyclopropyl)-N-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methanesulfonamide (PubChem CID 137072840) has the molecular formula C18H22Cl2N6O2S and a molecular weight of 457.39 g/mol. Its IUPAC name is 1-(2,2-dichlorocyclopropyl)-N-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methanesulfonamide.
| Compound Name | 1-(2,2-dichlorocyclopropyl)-N-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methanesulfonamide |
|---|---|
| PubChem CID | 137072840 |
| Molecular Formula | C18H22Cl2N6O2S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 1-(2,2-dichlorocyclopropyl)-N-[3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]methanesulfonamide |
| SMILES | CCC1CC(NS(=O)(=O)CC2CC2(Cl)Cl)CC1c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H22Cl2N6O2S/c1-2-10-5-12(25-29(27,28)9-11-7-18(11,19)20)6-13(10)17-24-23-15-8-22-16-14(26(15)17)3-4-21-16/h3-4,8,10-13,21,25H,2,5-7,9H2,1H3 |
| InChIKey | XPMSRLVVIKMVNR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|