C11H17N5O — CID 137167951
7-amino-2-hexyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 137167951) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 7-amino-2-hexyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 7-amino-2-hexyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 137167951 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 7-amino-2-hexyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | CCCCCCc1nc2[nH]c(=O)cc(N)n2n1 |
| InChI | InChI=1S/C11H17N5O/c1-2-3-4-5-6-9-13-11-14-10(17)7-8(12)16(11)15-9/h7H,2-6,12H2,1H3,(H,13,14,15,17) |
| InChIKey | HOQRMYVJTGKSES-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|