C13H7BrCl2INO — CID 137173116
4-bromo-2-[(2,4-dichlorophenyl)iminomethyl]-6-iodophenol (PubChem CID 137173116) has the molecular formula C13H7BrCl2INO and a molecular weight of 470.92 g/mol. Its IUPAC name is 4-bromo-2-[(2,4-dichlorophenyl)iminomethyl]-6-iodophenol.
| Compound Name | 4-bromo-2-[(2,4-dichlorophenyl)iminomethyl]-6-iodophenol |
|---|---|
| PubChem CID | 137173116 |
| Molecular Formula | C13H7BrCl2INO |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 468.81 |
| IUPAC Name | 4-bromo-2-[(2,4-dichlorophenyl)iminomethyl]-6-iodophenol |
| SMILES | Oc1c(I)cc(Br)cc1/C=N/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7BrCl2INO/c14-8-3-7(13(19)11(17)4-8)6-18-12-2-1-9(15)5-10(12)16/h1-6,19H/b18-6+ |
| InChIKey | MAXPUEYPSXVPPA-NGYBGAFCSA-N |
| XLogP | 5.82 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|