C10H10N2O2 — CID 137175529
3-(2-methylphenyl)-4H-1,2,4-oxadiazin-5-one (PubChem CID 137175529) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-(2-methylphenyl)-4H-1,2,4-oxadiazin-5-one.
| Compound Name | 3-(2-methylphenyl)-4H-1,2,4-oxadiazin-5-one |
|---|---|
| PubChem CID | 137175529 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-(2-methylphenyl)-4H-1,2,4-oxadiazin-5-one |
| SMILES | Cc1ccccc1C1=NOCC(=O)N1 |
| InChI | InChI=1S/C10H10N2O2/c1-7-4-2-3-5-8(7)10-11-9(13)6-14-12-10/h2-5H,6H2,1H3,(H,11,12,13) |
| InChIKey | ULPCIMUKZOBHLW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |