C32H34N4O3 — CID 143886332
3-[2-[4-[[4-butyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazin-5-one (PubChem CID 143886332) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 3-[2-[4-[[4-butyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazin-5-one.
| Compound Name | 3-[2-[4-[[4-butyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazin-5-one |
|---|---|
| PubChem CID | 143886332 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-[2-[4-[[4-butyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-methyl-6-oxopyrimidin-5-yl]methyl]phenyl]phenyl]-4H-1,2,4-oxadiazin-5-one |
| SMILES | C=C/C=C\C(=C/C)n1c(C)nc(CCCC)c(Cc2ccc(-c3ccccc3C3=NOCC(=O)N3)cc2)c1=O |
| InChI | InChI=1S/C32H34N4O3/c1-5-8-12-25(7-3)36-22(4)33-29(15-9-6-2)28(32(36)38)20-23-16-18-24(19-17-23)26-13-10-11-14-27(26)31-34-30(37)21-39-35-31/h5,7-8,10-14,16-19H,1,6,9,15,20-21H2,2-4H3,(H,34,35,37)/b12-8-,25-7+ |
| InChIKey | YRATVZUWJHBUNP-VGXWJEIWSA-N |
| XLogP | 5.56 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|