About Naphthoxazine EthoxySilane
Naphthoxazine EthoxySilane (PubChem CID 137175570) has the molecular formula C14H14NO2Si
and a molecular weight of 256.36 g/mol.
Molecular Properties
| Compound Name | Naphthoxazine EthoxySilane |
| PubChem CID | 137175570 |
| Molecular Formula | C14H14NO2Si |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | — |
| SMILES | C1=Cc2c(ccc3ccccc23)ON1.CCO[Si] |
| InChI | InChI=1S/C12H9NO.C2H5OSi/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-14-12;1-2-3-4/h1-8,13H;2H2,1H3 |
| InChIKey | BQJFCJDLRXXPMY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Naphthoxazine EthoxySilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Naphthoxazine EthoxySilane?
The IUPAC name of Naphthoxazine EthoxySilane (CID 137175570) is not available.
What is the SMILES notation for Naphthoxazine EthoxySilane?
The canonical SMILES for Naphthoxazine EthoxySilane is C1=Cc2c(ccc3ccccc23)ON1.CCO[Si].
What is the InChIKey of Naphthoxazine EthoxySilane?
The InChIKey is BQJFCJDLRXXPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO.C2H5OSi/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-14-12;1-2-3-4/h1-8,13H;2H2,1H3.
What are the key properties of Naphthoxazine EthoxySilane?
Naphthoxazine EthoxySilane has a molecular weight of 256.36 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Naphthoxazine EthoxySilane is sourced from PubChem (CID 137175570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).