C9H10N4O4 — CID 137183880
ethyl 2-cyano-2-(6-methoxy-2-oxo-1H-1,3,5-triazin-4-ylidene)acetate (PubChem CID 137183880) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is ethyl 2-cyano-2-(6-methoxy-2-oxo-1H-1,3,5-triazin-4-ylidene)acetate.
| Compound Name | ethyl 2-cyano-2-(6-methoxy-2-oxo-1H-1,3,5-triazin-4-ylidene)acetate |
|---|---|
| PubChem CID | 137183880 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | ethyl 2-cyano-2-(6-methoxy-2-oxo-1H-1,3,5-triazin-4-ylidene)acetate |
| SMILES | CCOC(=O)C(C#N)=C1N=C(OC)NC(=O)N1 |
| InChI | InChI=1S/C9H10N4O4/c1-3-17-7(14)5(4-10)6-11-8(15)13-9(12-6)16-2/h3H2,1-2H3,(H2,11,12,13,15) |
| InChIKey | DKXSORAFTMKEAX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|