C29H31N4O3S+ — CID 137189639
(6S)-7-acetyl-3-butylsulfanyl-6-(2-propoxynaphthalen-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189639) has the molecular formula C29H31N4O3S+ and a molecular weight of 515.66 g/mol. Its IUPAC name is (6S)-7-acetyl-3-butylsulfanyl-6-(2-propoxynaphthalen-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-7-acetyl-3-butylsulfanyl-6-(2-propoxynaphthalen-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189639 |
| Molecular Formula | C29H31N4O3S+ |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | (6S)-7-acetyl-3-butylsulfanyl-6-(2-propoxynaphthalen-1-yl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)[C@@H]2c1c(OCCC)ccc2ccccc12 |
| InChI | InChI=1S/C29H30N4O3S/c1-4-6-18-37-29-30-27(35)26-22-13-9-10-14-23(22)32(19(3)34)28(33(26)31-29)25-21-12-8-7-11-20(21)15-16-24(25)36-17-5-2/h7-16,28H,4-6,17-18H2,1-3H3/p+1/t28-/m0/s1 |
| InChIKey | YNKWKMPXIJHUTQ-NDEPHWFRSA-O |
| XLogP | 5.47 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|