C16H29N3 — CID 137194720
4-tert-butyl-2-methyl-N-(piperidin-4-ylmethyl)-2,3-dihydro-1H-pyridin-6-imine (PubChem CID 137194720) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 4-tert-butyl-2-methyl-N-(piperidin-4-ylmethyl)-2,3-dihydro-1H-pyridin-6-imine.
| Compound Name | 4-tert-butyl-2-methyl-N-(piperidin-4-ylmethyl)-2,3-dihydro-1H-pyridin-6-imine |
|---|---|
| PubChem CID | 137194720 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 4-tert-butyl-2-methyl-N-(piperidin-4-ylmethyl)-2,3-dihydro-1H-pyridin-6-imine |
| SMILES | CC1CC(C(C)(C)C)=C/C(=N\CC2CCNCC2)N1 |
| InChI | InChI=1S/C16H29N3/c1-12-9-14(16(2,3)4)10-15(19-12)18-11-13-5-7-17-8-6-13/h10,12-13,17H,5-9,11H2,1-4H3,(H,18,19) |
| InChIKey | PCDKBNOESBZZIS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|