C9H7NS — CID 137210187
(5Z,7Z,9E)-thieno[3,2-b]azocine (PubChem CID 137210187) has the molecular formula C9H7NS and a molecular weight of 161.23 g/mol. Its IUPAC name is (5Z,7Z,9E)-thieno[3,2-b]azocine.
| Compound Name | (5Z,7Z,9E)-thieno[3,2-b]azocine |
|---|---|
| PubChem CID | 137210187 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | (5Z,7Z,9E)-thieno[3,2-b]azocine |
| SMILES | C1=C\C=c2\scc\c2=N\C=C/1 |
| InChI | InChI=1S/C9H7NS/c1-2-4-9-8(5-7-11-9)10-6-3-1/h1-7H/b2-1-,3-1-,4-2-,6-3-,9-4+,10-6-,10-8- |
| InChIKey | PCLRGAHHHMYWTR-VISKWSNYSA-N |
| XLogP | 1.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |