About Thienoazocine
Thienoazocine (PubChem CID 137210187) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is (5Z,7Z,9E)-thieno[3,2-b]azocine.
Molecular Properties
| Compound Name | Thienoazocine |
| PubChem CID | 137210187 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | (5Z,7Z,9E)-thieno[3,2-b]azocine |
| SMILES | C\1=C\C=C\2/C(=N\C=C1)C=CS2 |
| InChI | InChI=1S/C9H7NS/c1-2-4-9-8(5-7-11-9)10-6-3-1/h1-7H/b2-1-,3-1?,4-2?,6-3-,9-4+,10-6?,10-8? |
| InChIKey | PCLRGAHHHMYWTR-CYISODAQSA-N |
| XLogP | 2.20 |
| TPSA | 37.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 306 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Thienoazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Thienoazocine?
The IUPAC name of Thienoazocine (CID 137210187) is (5Z,7Z,9E)-thieno[3,2-b]azocine.
What is the SMILES notation for Thienoazocine?
The canonical SMILES for Thienoazocine is C\1=C\C=C\2/C(=N\C=C1)C=CS2.
What is the InChIKey of Thienoazocine?
The InChIKey is PCLRGAHHHMYWTR-CYISODAQSA-N. The full InChI is InChI=1S/C9H7NS/c1-2-4-9-8(5-7-11-9)10-6-3-1/h1-7H/b2-1-,3-1?,4-2?,6-3-,9-4+,10-6?,10-8?.
What are the key properties of Thienoazocine?
Thienoazocine has a molecular weight of 161.23 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Thienoazocine is sourced from PubChem (CID 137210187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).