C15H15F4NO3 — CID 137211296
ethyl (E)-2-(benzyliminomethyl)-4,4,5,5-tetrafluoro-3-hydroxypent-2-enoate (PubChem CID 137211296) has the molecular formula C15H15F4NO3 and a molecular weight of 333.28 g/mol. Its IUPAC name is ethyl (E)-2-(benzyliminomethyl)-4,4,5,5-tetrafluoro-3-hydroxypent-2-enoate.
| Compound Name | ethyl (E)-2-(benzyliminomethyl)-4,4,5,5-tetrafluoro-3-hydroxypent-2-enoate |
|---|---|
| PubChem CID | 137211296 |
| Molecular Formula | C15H15F4NO3 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | ethyl (E)-2-(benzyliminomethyl)-4,4,5,5-tetrafluoro-3-hydroxypent-2-enoate |
| SMILES | CCOC(=O)C(/C=N/Cc1ccccc1)=C(/O)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H15F4NO3/c1-2-23-13(22)11(12(21)15(18,19)14(16)17)9-20-8-10-6-4-3-5-7-10/h3-7,9,14,21H,2,8H2,1H3/b12-11+,20-9+ |
| InChIKey | RRJKXYKQLVYHTQ-XCUCPWLCSA-N |
| XLogP | 3.53 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|