C15H10F3N3O7 — CID 137219981
7-hydroxy-8-methoxy-4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 137219981) has the molecular formula C15H10F3N3O7 and a molecular weight of 401.25 g/mol. Its IUPAC name is 7-hydroxy-8-methoxy-4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 7-hydroxy-8-methoxy-4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 137219981 |
| Molecular Formula | C15H10F3N3O7 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 7-hydroxy-8-methoxy-4-oxo-3H-pyrimido[4,5-b]quinoline-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc2nc3nc(C(=O)O)[nH]c(=O)c3cc2cc1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H9N3O5.C2HF3O2/c1-21-9-4-7-5(3-8(9)17)2-6-10(14-7)15-11(13(19)20)16-12(6)18;3-2(4,5)1(6)7/h2-4,17H,1H3,(H,19,20)(H,14,15,16,18);(H,6,7) |
| InChIKey | PVFAVKAQHOQOHD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|