C10H10N2O6S — CID 140528565
(6-hydroxy-7-methoxy-4-oxo-3H-quinazolin-2-yl) methanesulfonate (PubChem CID 140528565) has the molecular formula C10H10N2O6S and a molecular weight of 286.27 g/mol. Its IUPAC name is (6-hydroxy-7-methoxy-4-oxo-3H-quinazolin-2-yl) methanesulfonate.
| Compound Name | (6-hydroxy-7-methoxy-4-oxo-3H-quinazolin-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 140528565 |
| Molecular Formula | C10H10N2O6S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | (6-hydroxy-7-methoxy-4-oxo-3H-quinazolin-2-yl) methanesulfonate |
| SMILES | COc1cc2nc(OS(C)(=O)=O)[nH]c(=O)c2cc1O |
| InChI | InChI=1S/C10H10N2O6S/c1-17-8-4-6-5(3-7(8)13)9(14)12-10(11-6)18-19(2,15)16/h3-4,13H,1-2H3,(H,11,12,14) |
| InChIKey | HMFASDNSPYAGQZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|