C14H17ClN4O2 — CID 137222864
N-[1-(4-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1H-imidazol-3-ium-3-yl)acetamide chloride (PubChem CID 137222864) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1H-imidazol-3-ium-3-yl)acetamide chloride.
| Compound Name | N-[1-(4-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1H-imidazol-3-ium-3-yl)acetamide chloride |
|---|---|
| PubChem CID | 137222864 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1H-imidazol-3-ium-3-yl)acetamide chloride |
| SMILES | CC(=NNC(=O)C[n+]1cc[nH]c1C)c1ccc(O)cc1.[Cl-] |
| InChI | InChI=1S/C14H16N4O2.ClH/c1-10(12-3-5-13(19)6-4-12)16-17-14(20)9-18-8-7-15-11(18)2;/h3-8H,9H2,1-2H3,(H2,16,17,19,20);1H |
| InChIKey | XULOPMYUABVXQY-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|