C14H12N2O6 — CID 137234513
N,4-dihydroxy-5-nitro-6-phenacylcyclohexa-2,4-dien-1-imine oxide (PubChem CID 137234513) has the molecular formula C14H12N2O6 and a molecular weight of 304.26 g/mol. Its IUPAC name is N,4-dihydroxy-5-nitro-6-phenacylcyclohexa-2,4-dien-1-imine oxide.
| Compound Name | N,4-dihydroxy-5-nitro-6-phenacylcyclohexa-2,4-dien-1-imine oxide |
|---|---|
| PubChem CID | 137234513 |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N,4-dihydroxy-5-nitro-6-phenacylcyclohexa-2,4-dien-1-imine oxide |
| SMILES | O=C(CC1C([N+](=O)[O-])=C(O)C=CC1=[N+]([O-])O)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O6/c17-12-7-6-11(15(19)20)10(14(12)16(21)22)8-13(18)9-4-2-1-3-5-9/h1-7,10,17H,8H2,(H,19,20) |
| InChIKey | HIHJVRQUARXSBZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|