C31H32Br2N4O3S — CID 137236892
(6S)-6-(2,3-dibromo-5-methoxy-4-phenylmethoxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236892) has the molecular formula C31H32Br2N4O3S and a molecular weight of 700.50 g/mol. Its IUPAC name is (6S)-6-(2,3-dibromo-5-methoxy-4-phenylmethoxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-6-(2,3-dibromo-5-methoxy-4-phenylmethoxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236892 |
| Molecular Formula | C31H32Br2N4O3S |
| Molecular Weight | 700.50 g/mol |
| Exact Mass | 698.06 |
| IUPAC Name | (6S)-6-(2,3-dibromo-5-methoxy-4-phenylmethoxyphenyl)-3-heptylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | CCCCCCCSC1=NN2C(=c3ccccc3=N[C@@H]2c2cc(OC)c(OCc3ccccc3)c(Br)c2Br)C(=O)N1 |
| InChI | InChI=1S/C31H32Br2N4O3S/c1-3-4-5-6-12-17-41-31-35-30(38)27-21-15-10-11-16-23(21)34-29(37(27)36-31)22-18-24(39-2)28(26(33)25(22)32)40-19-20-13-8-7-9-14-20/h7-11,13-16,18,29H,3-6,12,17,19H2,1-2H3,(H,35,36,38)/t29-/m0/s1 |
| InChIKey | YROJODOIPPOQQW-LJAQVGFWSA-N |
| XLogP | 6.65 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.50 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|