About 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate
9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate (PubChem CID 137240740) has the molecular formula C17H13N3O3
and a molecular weight of 307.31 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate |
| PubChem CID | 137240740 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate |
| SMILES | [N-]=[N+]=C(N)C(=O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H13N3O3/c18-16(20-19)15(21)17(22)23-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9,18H2 |
| InChIKey | LOFQMOILLYMRIL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate?
The IUPAC name of 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate (CID 137240740) is 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate?
The canonical SMILES for 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate is [N-]=[N+]=C(N)C(=O)C(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate?
The InChIKey is LOFQMOILLYMRIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O3/c18-16(20-19)15(21)17(22)23-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9,18H2.
What are the key properties of 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate?
9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate has a molecular weight of 307.31 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl 3-amino-3-diazo-2-oxopropanoate is sourced from PubChem (CID 137240740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).