C34H38N4O6 — CID 137248916
(17R,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-8,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid (PubChem CID 137248916) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is (17R,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-8,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid.
| Compound Name | (17R,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-8,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 137248916 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | (17R,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-8,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c2[nH]c(c1C)C=C1N=C(C(CC(=O)O)=c3[nH]c(c(C)c3C(=O)O)=CC3=C(CC)C(C)C(=C2)N3)[C@@H](CCC(=O)O)[C@H]1C |
| InChI | InChI=1S/C34H38N4O6/c1-7-19-15(3)23-12-25-17(5)21(9-10-29(39)40)32(37-25)22(11-30(41)42)33-31(34(43)44)18(6)26(38-33)14-28-20(8-2)16(4)24(36-28)13-27(19)35-23/h7,12-14,16-17,21,35-36,38H,1,8-11H2,2-6H3,(H,39,40)(H,41,42)(H,43,44)/t16?,17-,21+/m1/s1 |
| InChIKey | ABILKSHGWPHVBS-IMPPOJTNSA-N |
| XLogP | 4.58 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |