C34H38N4O6 — CID 154041396
(17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-5,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid (PubChem CID 154041396) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is (17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-5,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-5,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 154041396 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | (17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-5,17,18,21,22,23-hexahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2[nH]c1=Cc1[nH]c(c(CC)c1C)Cc1[nH]c(c(C(=O)O)c1C)C(CC(=O)O)=C1N=C(C=2)[C@@H](C)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C34H38N4O6/c1-7-19-15(3)23-12-25-17(5)21(9-10-29(39)40)32(37-25)22(11-30(41)42)33-31(34(43)44)18(6)26(38-33)14-28-20(8-2)16(4)24(36-28)13-27(19)35-23/h7,12-13,17,21,35-36,38H,1,8-11,14H2,2-6H3,(H,39,40)(H,41,42)(H,43,44)/t17-,21-/m0/s1 |
| InChIKey | ZQYBRPPAKIIZSS-UWJYYQICSA-N |
| XLogP | 4.47 |
| TPSA | 171.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |