C20H24N6 — CID 137249616
N-methyl-1-(3-methylbutyl)-3-(3-methyl-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 137249616) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-methyl-1-(3-methylbutyl)-3-(3-methyl-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-methyl-1-(3-methylbutyl)-3-(3-methyl-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137249616 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | N-methyl-1-(3-methylbutyl)-3-(3-methyl-1H-indol-2-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CNc1ncnc2c1c(-c1[nH]c3ccccc3c1C)nn2CCC(C)C |
| InChI | InChI=1S/C20H24N6/c1-12(2)9-10-26-20-16(19(21-4)22-11-23-20)18(25-26)17-13(3)14-7-5-6-8-15(14)24-17/h5-8,11-12,24H,9-10H2,1-4H3,(H,21,22,23) |
| InChIKey | YFVJCOKTVZVARK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|