C52H37N5O — CID 137252785
5-methyl-2-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]iminomethyl]phenol (PubChem CID 137252785) has the molecular formula C52H37N5O and a molecular weight of 747.90 g/mol. Its IUPAC name is 5-methyl-2-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]iminomethyl]phenol.
| Compound Name | 5-methyl-2-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137252785 |
| Molecular Formula | C52H37N5O |
| Molecular Weight | 747.90 g/mol |
| Exact Mass | 747.30 |
| IUPAC Name | 5-methyl-2-[[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]iminomethyl]phenol |
| SMILES | Cc1ccc(/C=N/c2ccc(-c3c4nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[nH]6)C=C5)C=C4)cc2)c(O)c1 |
| InChI | InChI=1S/C52H37N5O/c1-33-17-18-38(48(58)31-33)32-53-39-21-19-37(20-22-39)52-46-29-27-44(56-46)50(35-13-7-3-8-14-35)42-25-23-40(54-42)49(34-11-5-2-6-12-34)41-24-26-43(55-41)51(36-15-9-4-10-16-36)45-28-30-47(52)57-45/h2-32,54,57-58H,1H3/b49-40-,49-41-,50-42-,50-44-,51-43-,51-45-,52-46-,52-47-,53-32+ |
| InChIKey | DBIGMMLXCMTMLI-AYPUFDLMSA-N |
| XLogP | 13.09 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.90 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|