C14H11F3N4O — CID 137254721
2,8-dimethyl-7-[3-(trifluoromethyl)phenyl]-1H-purin-6-one (PubChem CID 137254721) has the molecular formula C14H11F3N4O and a molecular weight of 308.26 g/mol. Its IUPAC name is 2,8-dimethyl-7-[3-(trifluoromethyl)phenyl]-1H-purin-6-one.
| Compound Name | 2,8-dimethyl-7-[3-(trifluoromethyl)phenyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137254721 |
| Molecular Formula | C14H11F3N4O |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2,8-dimethyl-7-[3-(trifluoromethyl)phenyl]-1H-purin-6-one |
| SMILES | Cc1nc2nc(C)n(-c3cccc(C(F)(F)F)c3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H11F3N4O/c1-7-18-12-11(13(22)19-7)21(8(2)20-12)10-5-3-4-9(6-10)14(15,16)17/h3-6H,1-2H3,(H,18,19,22) |
| InChIKey | NRZDLXTVPXKPEC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |