C12H10N6O3 — CID 137254771
8-amino-2-methyl-7-(4-nitrophenyl)-1H-purin-6-one (PubChem CID 137254771) has the molecular formula C12H10N6O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 8-amino-2-methyl-7-(4-nitrophenyl)-1H-purin-6-one.
| Compound Name | 8-amino-2-methyl-7-(4-nitrophenyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 137254771 |
| Molecular Formula | C12H10N6O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 8-amino-2-methyl-7-(4-nitrophenyl)-1H-purin-6-one |
| SMILES | Cc1nc2nc(N)n(-c3ccc([N+](=O)[O-])cc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N6O3/c1-6-14-10-9(11(19)15-6)17(12(13)16-10)7-2-4-8(5-3-7)18(20)21/h2-5H,1H3,(H3,13,14,15,16,19) |
| InChIKey | ODPSAIDUWTTZNX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|