C11H9N7O3 — CID 10891485
3,6-diamino-5-(4-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 10891485) has the molecular formula C11H9N7O3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 3,6-diamino-5-(4-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 3,6-diamino-5-(4-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10891485 |
| Molecular Formula | C11H9N7O3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3,6-diamino-5-(4-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | Nc1[nH]nc2nc(N)n(-c3ccc([N+](=O)[O-])cc3)c(=O)c12 |
| InChI | InChI=1S/C11H9N7O3/c12-8-7-9(16-15-8)14-11(13)17(10(7)19)5-1-3-6(4-2-5)18(20)21/h1-4H,(H5,12,13,14,15,16) |
| InChIKey | AFJRQBWAWKFPCP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|