C11H8ClN5O — CID 137254797
8-amino-7-(2-chlorophenyl)-1H-purin-6-one (PubChem CID 137254797) has the molecular formula C11H8ClN5O and a molecular weight of 261.67 g/mol. Its IUPAC name is 8-amino-7-(2-chlorophenyl)-1H-purin-6-one.
| Compound Name | 8-amino-7-(2-chlorophenyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 137254797 |
| Molecular Formula | C11H8ClN5O |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 8-amino-7-(2-chlorophenyl)-1H-purin-6-one |
| SMILES | Nc1nc2nc[nH]c(=O)c2n1-c1ccccc1Cl |
| InChI | InChI=1S/C11H8ClN5O/c12-6-3-1-2-4-7(6)17-8-9(16-11(17)13)14-5-15-10(8)18/h1-5H,(H3,13,14,15,16,18) |
| InChIKey | ZYAKCMJRZYGFMM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |