About 7-iodo-1H-purin-6-one
7-iodo-1H-purin-6-one (PubChem CID 175230449) has the molecular formula C5H3IN4O
and a molecular weight of 262.01 g/mol. Its IUPAC name is 7-iodo-1H-purin-6-one.
Molecular Properties
| Compound Name | 7-iodo-1H-purin-6-one |
| PubChem CID | 175230449 |
| Molecular Formula | C5H3IN4O |
| Molecular Weight | 262.01 g/mol |
| Exact Mass | 261.94 |
| IUPAC Name | 7-iodo-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2ncn(I)c12 |
| InChI | InChI=1S/C5H3IN4O/c6-10-2-9-4-3(10)5(11)8-1-7-4/h1-2H,(H,7,8,11) |
| InChIKey | ZMJQXJYWPDJHKN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.01 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-1H-purin-6-one?
The IUPAC name of 7-iodo-1H-purin-6-one (CID 175230449) is 7-iodo-1H-purin-6-one.
What is the SMILES notation for 7-iodo-1H-purin-6-one?
The canonical SMILES for 7-iodo-1H-purin-6-one is O=c1[nH]cnc2ncn(I)c12.
What is the InChIKey of 7-iodo-1H-purin-6-one?
The InChIKey is ZMJQXJYWPDJHKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3IN4O/c6-10-2-9-4-3(10)5(11)8-1-7-4/h1-2H,(H,7,8,11).
What are the key properties of 7-iodo-1H-purin-6-one?
7-iodo-1H-purin-6-one has a molecular weight of 262.01 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-1H-purin-6-one is sourced from PubChem (CID 175230449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).